C12H10N4O2S2 — CID 107801222
6-amino-N-(1,3-benzothiazol-6-yl)pyridine-3-sulfonamide (PubChem CID 107801222) has the molecular formula C12H10N4O2S2 and a molecular weight of 306.37 g/mol. Its IUPAC name is 6-amino-N-(1,3-benzothiazol-6-yl)pyridine-3-sulfonamide.
| Compound Name | 6-amino-N-(1,3-benzothiazol-6-yl)pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 107801222 |
| Molecular Formula | C12H10N4O2S2 |
| Molecular Weight | 306.37 g/mol |
| Exact Mass | 306.02 |
| IUPAC Name | 6-amino-N-(1,3-benzothiazol-6-yl)pyridine-3-sulfonamide |
| SMILES | Nc1ccc(S(=O)(=O)Nc2ccc3ncsc3c2)cn1 |
| InChI | InChI=1S/C12H10N4O2S2/c13-12-4-2-9(6-14-12)20(17,18)16-8-1-3-10-11(5-8)19-7-15-10/h1-7,16H,(H2,13,14) |
| InChIKey | JQYGCVAOASIZIE-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 97.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.37 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |