C13H8Cl2N2O2S2 — CID 59823085
N-(1,3-benzothiazol-6-yl)-2,4-dichlorobenzenesulfonamide (PubChem CID 59823085) has the molecular formula C13H8Cl2N2O2S2 and a molecular weight of 359.26 g/mol. Its IUPAC name is N-(1,3-benzothiazol-6-yl)-2,4-dichlorobenzenesulfonamide.
| Compound Name | N-(1,3-benzothiazol-6-yl)-2,4-dichlorobenzenesulfonamide |
|---|---|
| PubChem CID | 59823085 |
| Molecular Formula | C13H8Cl2N2O2S2 |
| Molecular Weight | 359.26 g/mol |
| Exact Mass | 357.94 |
| IUPAC Name | N-(1,3-benzothiazol-6-yl)-2,4-dichlorobenzenesulfonamide |
| SMILES | O=S(=O)(Nc1ccc2ncsc2c1)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C13H8Cl2N2O2S2/c14-8-1-4-13(10(15)5-8)21(18,19)17-9-2-3-11-12(6-9)20-7-16-11/h1-7,17H |
| InChIKey | QHVGFLSZPPTYRZ-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.26 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |