C14H10ClFN2S — CID 107804043
N-[(4-chloro-2-fluorophenyl)methyl]-1,3-benzothiazol-6-amine (PubChem CID 107804043) has the molecular formula C14H10ClFN2S and a molecular weight of 292.77 g/mol. Its IUPAC name is N-[(4-chloro-2-fluorophenyl)methyl]-1,3-benzothiazol-6-amine.
| Compound Name | N-[(4-chloro-2-fluorophenyl)methyl]-1,3-benzothiazol-6-amine |
|---|---|
| PubChem CID | 107804043 |
| Molecular Formula | C14H10ClFN2S |
| Molecular Weight | 292.77 g/mol |
| Exact Mass | 292.02 |
| IUPAC Name | N-[(4-chloro-2-fluorophenyl)methyl]-1,3-benzothiazol-6-amine |
| SMILES | Fc1cc(Cl)ccc1CNc1ccc2ncsc2c1 |
| InChI | InChI=1S/C14H10ClFN2S/c15-10-2-1-9(12(16)5-10)7-17-11-3-4-13-14(6-11)19-8-18-13/h1-6,8,17H,7H2 |
| InChIKey | RWSPDTJKAHEZBU-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.77 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |