C11H10Br2N2O2S2 — CID 106088925
4-(aminomethyl)-N-(2,6-dibromophenyl)thiophene-2-sulfonamide (PubChem CID 106088925) has the molecular formula C11H10Br2N2O2S2 and a molecular weight of 426.16 g/mol. Its IUPAC name is 4-(aminomethyl)-N-(2,6-dibromophenyl)thiophene-2-sulfonamide.
| Compound Name | 4-(aminomethyl)-N-(2,6-dibromophenyl)thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 106088925 |
| Molecular Formula | C11H10Br2N2O2S2 |
| Molecular Weight | 426.16 g/mol |
| Exact Mass | 423.86 |
| IUPAC Name | 4-(aminomethyl)-N-(2,6-dibromophenyl)thiophene-2-sulfonamide |
| SMILES | NCc1csc(S(=O)(=O)Nc2c(Br)cccc2Br)c1 |
| InChI | InChI=1S/C11H10Br2N2O2S2/c12-8-2-1-3-9(13)11(8)15-19(16,17)10-4-7(5-14)6-18-10/h1-4,6,15H,5,14H2 |
| InChIKey | KZKBNMUTYIHMTJ-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.16 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |