C11H9Cl3N2O2S2 — CID 106057742
4-(aminomethyl)-N-(2,4,5-trichlorophenyl)thiophene-2-sulfonamide (PubChem CID 106057742) has the molecular formula C11H9Cl3N2O2S2 and a molecular weight of 371.70 g/mol. Its IUPAC name is 4-(aminomethyl)-N-(2,4,5-trichlorophenyl)thiophene-2-sulfonamide.
| Compound Name | 4-(aminomethyl)-N-(2,4,5-trichlorophenyl)thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 106057742 |
| Molecular Formula | C11H9Cl3N2O2S2 |
| Molecular Weight | 371.70 g/mol |
| Exact Mass | 369.92 |
| IUPAC Name | 4-(aminomethyl)-N-(2,4,5-trichlorophenyl)thiophene-2-sulfonamide |
| SMILES | NCc1csc(S(=O)(=O)Nc2cc(Cl)c(Cl)cc2Cl)c1 |
| InChI | InChI=1S/C11H9Cl3N2O2S2/c12-7-2-9(14)10(3-8(7)13)16-20(17,18)11-1-6(4-15)5-19-11/h1-3,5,16H,4,15H2 |
| InChIKey | FWZLPCLGRKYMFS-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.70 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|