C11H8F4N2O2S2 — CID 106087571
4-(aminomethyl)-N-(2,3,5,6-tetrafluorophenyl)thiophene-2-sulfonamide (PubChem CID 106087571) has the molecular formula C11H8F4N2O2S2 and a molecular weight of 340.32 g/mol. Its IUPAC name is 4-(aminomethyl)-N-(2,3,5,6-tetrafluorophenyl)thiophene-2-sulfonamide.
| Compound Name | 4-(aminomethyl)-N-(2,3,5,6-tetrafluorophenyl)thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 106087571 |
| Molecular Formula | C11H8F4N2O2S2 |
| Molecular Weight | 340.32 g/mol |
| Exact Mass | 340.00 |
| IUPAC Name | 4-(aminomethyl)-N-(2,3,5,6-tetrafluorophenyl)thiophene-2-sulfonamide |
| SMILES | NCc1csc(S(=O)(=O)Nc2c(F)c(F)cc(F)c2F)c1 |
| InChI | InChI=1S/C11H8F4N2O2S2/c12-6-2-7(13)10(15)11(9(6)14)17-21(18,19)8-1-5(3-16)4-20-8/h1-2,4,17H,3,16H2 |
| InChIKey | RPCSKOKTTBRITF-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.32 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|