C10H18N2O2S3 — CID 106064908
4-(aminomethyl)-N-(2-methyl-3-methylsulfanylpropyl)thiophene-2-sulfonamide (PubChem CID 106064908) has the molecular formula C10H18N2O2S3 and a molecular weight of 294.47 g/mol. Its IUPAC name is 4-(aminomethyl)-N-(2-methyl-3-methylsulfanylpropyl)thiophene-2-sulfonamide.
| Compound Name | 4-(aminomethyl)-N-(2-methyl-3-methylsulfanylpropyl)thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 106064908 |
| Molecular Formula | C10H18N2O2S3 |
| Molecular Weight | 294.47 g/mol |
| Exact Mass | 294.05 |
| IUPAC Name | 4-(aminomethyl)-N-(2-methyl-3-methylsulfanylpropyl)thiophene-2-sulfonamide |
| SMILES | CSCC(C)CNS(=O)(=O)c1cc(CN)cs1 |
| InChI | InChI=1S/C10H18N2O2S3/c1-8(6-15-2)5-12-17(13,14)10-3-9(4-11)7-16-10/h3,7-8,12H,4-6,11H2,1-2H3 |
| InChIKey | MTQCNHUBGCSDEF-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.47 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |