C12H23N3O2S2 — CID 106095139
4-(aminomethyl)-N-[3-[methyl(propan-2-yl)amino]propyl]thiophene-2-sulfonamide (PubChem CID 106095139) has the molecular formula C12H23N3O2S2 and a molecular weight of 305.47 g/mol. Its IUPAC name is 4-(aminomethyl)-N-[3-[methyl(propan-2-yl)amino]propyl]thiophene-2-sulfonamide.
| Compound Name | 4-(aminomethyl)-N-[3-[methyl(propan-2-yl)amino]propyl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 106095139 |
| Molecular Formula | C12H23N3O2S2 |
| Molecular Weight | 305.47 g/mol |
| Exact Mass | 305.12 |
| IUPAC Name | 4-(aminomethyl)-N-[3-[methyl(propan-2-yl)amino]propyl]thiophene-2-sulfonamide |
| SMILES | CC(C)N(C)CCCNS(=O)(=O)c1cc(CN)cs1 |
| InChI | InChI=1S/C12H23N3O2S2/c1-10(2)15(3)6-4-5-14-19(16,17)12-7-11(8-13)9-18-12/h7,9-10,14H,4-6,8,13H2,1-3H3 |
| InChIKey | YPJQRUYUMIKECZ-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.47 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|