C10H18N2O3S2 — CID 114133354
N-[3-(dimethylamino)propyl]-4-(hydroxymethyl)thiophene-2-sulfonamide (PubChem CID 114133354) has the molecular formula C10H18N2O3S2 and a molecular weight of 278.40 g/mol. Its IUPAC name is N-[3-(dimethylamino)propyl]-4-(hydroxymethyl)thiophene-2-sulfonamide.
| Compound Name | N-[3-(dimethylamino)propyl]-4-(hydroxymethyl)thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 114133354 |
| Molecular Formula | C10H18N2O3S2 |
| Molecular Weight | 278.40 g/mol |
| Exact Mass | 278.08 |
| IUPAC Name | N-[3-(dimethylamino)propyl]-4-(hydroxymethyl)thiophene-2-sulfonamide |
| SMILES | CN(C)CCCNS(=O)(=O)c1cc(CO)cs1 |
| InChI | InChI=1S/C10H18N2O3S2/c1-12(2)5-3-4-11-17(14,15)10-6-9(7-13)8-16-10/h6,8,11,13H,3-5,7H2,1-2H3 |
| InChIKey | WRBPLUBPMZDJRO-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.40 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|