C12H19NO3S2 — CID 114132125
4-(hydroxymethyl)-N-(3-methylcyclohexyl)thiophene-2-sulfonamide (PubChem CID 114132125) has the molecular formula C12H19NO3S2 and a molecular weight of 289.42 g/mol. Its IUPAC name is 4-(hydroxymethyl)-N-(3-methylcyclohexyl)thiophene-2-sulfonamide.
| Compound Name | 4-(hydroxymethyl)-N-(3-methylcyclohexyl)thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 114132125 |
| Molecular Formula | C12H19NO3S2 |
| Molecular Weight | 289.42 g/mol |
| Exact Mass | 289.08 |
| IUPAC Name | 4-(hydroxymethyl)-N-(3-methylcyclohexyl)thiophene-2-sulfonamide |
| SMILES | CC1CCCC(NS(=O)(=O)c2cc(CO)cs2)C1 |
| InChI | InChI=1S/C12H19NO3S2/c1-9-3-2-4-11(5-9)13-18(15,16)12-6-10(7-14)8-17-12/h6,8-9,11,13-14H,2-5,7H2,1H3 |
| InChIKey | CIGKOWGNIDBECT-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.42 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |