C12H16N2O2S2 — CID 106267297
5-cyano-N-(3-methylcyclohexyl)thiophene-2-sulfonamide (PubChem CID 106267297) has the molecular formula C12H16N2O2S2 and a molecular weight of 284.41 g/mol. Its IUPAC name is 5-cyano-N-(3-methylcyclohexyl)thiophene-2-sulfonamide.
| Compound Name | 5-cyano-N-(3-methylcyclohexyl)thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 106267297 |
| Molecular Formula | C12H16N2O2S2 |
| Molecular Weight | 284.41 g/mol |
| Exact Mass | 284.07 |
| IUPAC Name | 5-cyano-N-(3-methylcyclohexyl)thiophene-2-sulfonamide |
| SMILES | CC1CCCC(NS(=O)(=O)c2ccc(C#N)s2)C1 |
| InChI | InChI=1S/C12H16N2O2S2/c1-9-3-2-4-10(7-9)14-18(15,16)12-6-5-11(8-13)17-12/h5-6,9-10,14H,2-4,7H2,1H3 |
| InChIKey | FAMDBZYJOWSAQE-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 69.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.41 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |