C11H14N2O2S2 — CID 106267298
5-cyano-N-(cyclopentylmethyl)thiophene-2-sulfonamide (PubChem CID 106267298) has the molecular formula C11H14N2O2S2 and a molecular weight of 270.38 g/mol. Its IUPAC name is 5-cyano-N-(cyclopentylmethyl)thiophene-2-sulfonamide.
| Compound Name | 5-cyano-N-(cyclopentylmethyl)thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 106267298 |
| Molecular Formula | C11H14N2O2S2 |
| Molecular Weight | 270.38 g/mol |
| Exact Mass | 270.05 |
| IUPAC Name | 5-cyano-N-(cyclopentylmethyl)thiophene-2-sulfonamide |
| SMILES | N#Cc1ccc(S(=O)(=O)NCC2CCCC2)s1 |
| InChI | InChI=1S/C11H14N2O2S2/c12-7-10-5-6-11(16-10)17(14,15)13-8-9-3-1-2-4-9/h5-6,9,13H,1-4,8H2 |
| InChIKey | FKKFQTOMOJLRSE-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 69.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.38 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |