C10H14N2O4S3 — CID 106268602
5-cyano-N-(2-methyl-2-methylsulfonylpropyl)thiophene-2-sulfonamide (PubChem CID 106268602) has the molecular formula C10H14N2O4S3 and a molecular weight of 322.43 g/mol. Its IUPAC name is 5-cyano-N-(2-methyl-2-methylsulfonylpropyl)thiophene-2-sulfonamide.
| Compound Name | 5-cyano-N-(2-methyl-2-methylsulfonylpropyl)thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 106268602 |
| Molecular Formula | C10H14N2O4S3 |
| Molecular Weight | 322.43 g/mol |
| Exact Mass | 322.01 |
| IUPAC Name | 5-cyano-N-(2-methyl-2-methylsulfonylpropyl)thiophene-2-sulfonamide |
| SMILES | CC(C)(CNS(=O)(=O)c1ccc(C#N)s1)S(C)(=O)=O |
| InChI | InChI=1S/C10H14N2O4S3/c1-10(2,18(3,13)14)7-12-19(15,16)9-5-4-8(6-11)17-9/h4-5,12H,7H2,1-3H3 |
| InChIKey | NXCVRKJCTAMZKN-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 104.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.43 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |