C9H12N2O3S3 — CID 114166393
5-cyano-N-(2-ethylsulfinylethyl)thiophene-2-sulfonamide (PubChem CID 114166393) has the molecular formula C9H12N2O3S3 and a molecular weight of 292.41 g/mol. Its IUPAC name is 5-cyano-N-(2-ethylsulfinylethyl)thiophene-2-sulfonamide.
| Compound Name | 5-cyano-N-(2-ethylsulfinylethyl)thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 114166393 |
| Molecular Formula | C9H12N2O3S3 |
| Molecular Weight | 292.41 g/mol |
| Exact Mass | 292.00 |
| IUPAC Name | 5-cyano-N-(2-ethylsulfinylethyl)thiophene-2-sulfonamide |
| SMILES | CCS(=O)CCNS(=O)(=O)c1ccc(C#N)s1 |
| InChI | InChI=1S/C9H12N2O3S3/c1-2-16(12)6-5-11-17(13,14)9-4-3-8(7-10)15-9/h3-4,11H,2,5-6H2,1H3 |
| InChIKey | FYUCIZRKKZBJHB-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 87.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.41 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |