C10H12N2O4S2 — CID 106265760
4-[(5-cyanothiophen-2-yl)sulfonylamino]-2-methylbutanoic acid (PubChem CID 106265760) has the molecular formula C10H12N2O4S2 and a molecular weight of 288.35 g/mol. Its IUPAC name is 4-[(5-cyanothiophen-2-yl)sulfonylamino]-2-methylbutanoic acid.
| Compound Name | 4-[(5-cyanothiophen-2-yl)sulfonylamino]-2-methylbutanoic acid |
|---|---|
| PubChem CID | 106265760 |
| Molecular Formula | C10H12N2O4S2 |
| Molecular Weight | 288.35 g/mol |
| Exact Mass | 288.02 |
| IUPAC Name | 4-[(5-cyanothiophen-2-yl)sulfonylamino]-2-methylbutanoic acid |
| SMILES | CC(CCNS(=O)(=O)c1ccc(C#N)s1)C(=O)O |
| InChI | InChI=1S/C10H12N2O4S2/c1-7(10(13)14)4-5-12-18(15,16)9-3-2-8(6-11)17-9/h2-3,7,12H,4-5H2,1H3,(H,13,14) |
| InChIKey | PFSFRNNXYZDBBR-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 107.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.35 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |