C8H9N3O4S2 — CID 114166352
2-[(5-cyanothiophen-2-yl)sulfonylamino]ethyl carbamate (PubChem CID 114166352) has the molecular formula C8H9N3O4S2 and a molecular weight of 275.31 g/mol. Its IUPAC name is 2-[(5-cyanothiophen-2-yl)sulfonylamino]ethyl carbamate.
| Compound Name | 2-[(5-cyanothiophen-2-yl)sulfonylamino]ethyl carbamate |
|---|---|
| PubChem CID | 114166352 |
| Molecular Formula | C8H9N3O4S2 |
| Molecular Weight | 275.31 g/mol |
| Exact Mass | 275.00 |
| IUPAC Name | 2-[(5-cyanothiophen-2-yl)sulfonylamino]ethyl carbamate |
| SMILES | N#Cc1ccc(S(=O)(=O)NCCOC(N)=O)s1 |
| InChI | InChI=1S/C8H9N3O4S2/c9-5-6-1-2-7(16-6)17(13,14)11-3-4-15-8(10)12/h1-2,11H,3-4H2,(H2,10,12) |
| InChIKey | XOOOURXJRFJSES-UHFFFAOYSA-N |
| XLogP | -0.01 |
| TPSA | 122.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.31 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|