C9H9F3N2O3S2 — CID 106268267
5-cyano-N-[2-(2,2,2-trifluoroethoxy)ethyl]thiophene-2-sulfonamide (PubChem CID 106268267) has the molecular formula C9H9F3N2O3S2 and a molecular weight of 314.31 g/mol. Its IUPAC name is 5-cyano-N-[2-(2,2,2-trifluoroethoxy)ethyl]thiophene-2-sulfonamide.
| Compound Name | 5-cyano-N-[2-(2,2,2-trifluoroethoxy)ethyl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 106268267 |
| Molecular Formula | C9H9F3N2O3S2 |
| Molecular Weight | 314.31 g/mol |
| Exact Mass | 314.00 |
| IUPAC Name | 5-cyano-N-[2-(2,2,2-trifluoroethoxy)ethyl]thiophene-2-sulfonamide |
| SMILES | N#Cc1ccc(S(=O)(=O)NCCOCC(F)(F)F)s1 |
| InChI | InChI=1S/C9H9F3N2O3S2/c10-9(11,12)6-17-4-3-14-19(15,16)8-2-1-7(5-13)18-8/h1-2,14H,3-4,6H2 |
| InChIKey | BZSKFLONQWFCBE-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 79.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.31 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|