C7H5F3N2O2S2 — CID 106267146
5-cyano-N-(2,2,2-trifluoroethyl)thiophene-2-sulfonamide (PubChem CID 106267146) has the molecular formula C7H5F3N2O2S2 and a molecular weight of 270.26 g/mol. Its IUPAC name is 5-cyano-N-(2,2,2-trifluoroethyl)thiophene-2-sulfonamide.
| Compound Name | 5-cyano-N-(2,2,2-trifluoroethyl)thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 106267146 |
| Molecular Formula | C7H5F3N2O2S2 |
| Molecular Weight | 270.26 g/mol |
| Exact Mass | 269.97 |
| IUPAC Name | 5-cyano-N-(2,2,2-trifluoroethyl)thiophene-2-sulfonamide |
| SMILES | N#Cc1ccc(S(=O)(=O)NCC(F)(F)F)s1 |
| InChI | InChI=1S/C7H5F3N2O2S2/c8-7(9,10)4-12-16(13,14)6-2-1-5(3-11)15-6/h1-2,12H,4H2 |
| InChIKey | ANJPXKBPGRURAK-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 69.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.26 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |