C13H25N3O3S2 — CID 106091614
N-[2-[2-(dimethylamino)ethoxy]ethyl]-4-(ethylaminomethyl)thiophene-2-sulfonamide (PubChem CID 106091614) has the molecular formula C13H25N3O3S2 and a molecular weight of 335.50 g/mol. Its IUPAC name is N-[2-[2-(dimethylamino)ethoxy]ethyl]-4-(ethylaminomethyl)thiophene-2-sulfonamide.
| Compound Name | N-[2-[2-(dimethylamino)ethoxy]ethyl]-4-(ethylaminomethyl)thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 106091614 |
| Molecular Formula | C13H25N3O3S2 |
| Molecular Weight | 335.50 g/mol |
| Exact Mass | 335.13 |
| IUPAC Name | N-[2-[2-(dimethylamino)ethoxy]ethyl]-4-(ethylaminomethyl)thiophene-2-sulfonamide |
| SMILES | CCNCc1csc(S(=O)(=O)NCCOCCN(C)C)c1 |
| InChI | InChI=1S/C13H25N3O3S2/c1-4-14-10-12-9-13(20-11-12)21(17,18)15-5-7-19-8-6-16(2)3/h9,11,14-15H,4-8,10H2,1-3H3 |
| InChIKey | TUHHGNVEAOHMDS-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.50 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|