C9H12N4O2S2 — CID 114134463
4-(aminomethyl)-N-(1-methylpyrazol-4-yl)thiophene-2-sulfonamide (PubChem CID 114134463) has the molecular formula C9H12N4O2S2 and a molecular weight of 272.36 g/mol. Its IUPAC name is 4-(aminomethyl)-N-(1-methylpyrazol-4-yl)thiophene-2-sulfonamide.
| Compound Name | 4-(aminomethyl)-N-(1-methylpyrazol-4-yl)thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 114134463 |
| Molecular Formula | C9H12N4O2S2 |
| Molecular Weight | 272.36 g/mol |
| Exact Mass | 272.04 |
| IUPAC Name | 4-(aminomethyl)-N-(1-methylpyrazol-4-yl)thiophene-2-sulfonamide |
| SMILES | Cn1cc(NS(=O)(=O)c2cc(CN)cs2)cn1 |
| InChI | InChI=1S/C9H12N4O2S2/c1-13-5-8(4-11-13)12-17(14,15)9-2-7(3-10)6-16-9/h2,4-6,12H,3,10H2,1H3 |
| InChIKey | LKBKKJPXXWWAFF-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 90.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.36 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |