C12H10Cl3N3O2S — CID 106057739
5-(aminomethyl)-N-(2,4,5-trichlorophenyl)pyridine-2-sulfonamide (PubChem CID 106057739) has the molecular formula C12H10Cl3N3O2S and a molecular weight of 366.66 g/mol. Its IUPAC name is 5-(aminomethyl)-N-(2,4,5-trichlorophenyl)pyridine-2-sulfonamide.
| Compound Name | 5-(aminomethyl)-N-(2,4,5-trichlorophenyl)pyridine-2-sulfonamide |
|---|---|
| PubChem CID | 106057739 |
| Molecular Formula | C12H10Cl3N3O2S |
| Molecular Weight | 366.66 g/mol |
| Exact Mass | 364.96 |
| IUPAC Name | 5-(aminomethyl)-N-(2,4,5-trichlorophenyl)pyridine-2-sulfonamide |
| SMILES | NCc1ccc(S(=O)(=O)Nc2cc(Cl)c(Cl)cc2Cl)nc1 |
| InChI | InChI=1S/C12H10Cl3N3O2S/c13-8-3-10(15)11(4-9(8)14)18-21(19,20)12-2-1-7(5-16)6-17-12/h1-4,6,18H,5,16H2 |
| InChIKey | GYPBAETWZGOXJA-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 85.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.66 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|