C13H13Br2N3O2S — CID 106002333
5-(aminomethyl)-N-(2,6-dibromo-4-methylphenyl)pyridine-2-sulfonamide (PubChem CID 106002333) has the molecular formula C13H13Br2N3O2S and a molecular weight of 435.14 g/mol. Its IUPAC name is 5-(aminomethyl)-N-(2,6-dibromo-4-methylphenyl)pyridine-2-sulfonamide.
| Compound Name | 5-(aminomethyl)-N-(2,6-dibromo-4-methylphenyl)pyridine-2-sulfonamide |
|---|---|
| PubChem CID | 106002333 |
| Molecular Formula | C13H13Br2N3O2S |
| Molecular Weight | 435.14 g/mol |
| Exact Mass | 432.91 |
| IUPAC Name | 5-(aminomethyl)-N-(2,6-dibromo-4-methylphenyl)pyridine-2-sulfonamide |
| SMILES | Cc1cc(Br)c(NS(=O)(=O)c2ccc(CN)cn2)c(Br)c1 |
| InChI | InChI=1S/C13H13Br2N3O2S/c1-8-4-10(14)13(11(15)5-8)18-21(19,20)12-3-2-9(6-16)7-17-12/h2-5,7,18H,6,16H2,1H3 |
| InChIKey | CAXFXUDJBBXICF-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 85.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.14 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |