C11H9Cl3N4O2S — CID 103300792
3-hydrazinyl-N-(2,4,5-trichlorophenyl)pyridine-2-sulfonamide (PubChem CID 103300792) has the molecular formula C11H9Cl3N4O2S and a molecular weight of 367.65 g/mol. Its IUPAC name is 3-hydrazinyl-N-(2,4,5-trichlorophenyl)pyridine-2-sulfonamide.
| Compound Name | 3-hydrazinyl-N-(2,4,5-trichlorophenyl)pyridine-2-sulfonamide |
|---|---|
| PubChem CID | 103300792 |
| Molecular Formula | C11H9Cl3N4O2S |
| Molecular Weight | 367.65 g/mol |
| Exact Mass | 365.95 |
| IUPAC Name | 3-hydrazinyl-N-(2,4,5-trichlorophenyl)pyridine-2-sulfonamide |
| SMILES | NNc1cccnc1S(=O)(=O)Nc1cc(Cl)c(Cl)cc1Cl |
| InChI | InChI=1S/C11H9Cl3N4O2S/c12-6-4-8(14)10(5-7(6)13)18-21(19,20)11-9(17-15)2-1-3-16-11/h1-5,17-18H,15H2 |
| InChIKey | DPTLJDALIAIXKO-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 97.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.65 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|