C8H9N5O2S2 — CID 103300842
3-hydrazinyl-N-(1,3-thiazol-2-yl)pyridine-2-sulfonamide (PubChem CID 103300842) has the molecular formula C8H9N5O2S2 and a molecular weight of 271.33 g/mol. Its IUPAC name is 3-hydrazinyl-N-(1,3-thiazol-2-yl)pyridine-2-sulfonamide.
| Compound Name | 3-hydrazinyl-N-(1,3-thiazol-2-yl)pyridine-2-sulfonamide |
|---|---|
| PubChem CID | 103300842 |
| Molecular Formula | C8H9N5O2S2 |
| Molecular Weight | 271.33 g/mol |
| Exact Mass | 271.02 |
| IUPAC Name | 3-hydrazinyl-N-(1,3-thiazol-2-yl)pyridine-2-sulfonamide |
| SMILES | NNc1cccnc1S(=O)(=O)Nc1nccs1 |
| InChI | InChI=1S/C8H9N5O2S2/c9-12-6-2-1-3-10-7(6)17(14,15)13-8-11-4-5-16-8/h1-5,12H,9H2,(H,11,13) |
| InChIKey | NFMGUOYVVRUABQ-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 110.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.33 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|