C10H13N5O2S2 — CID 103301102
N-(4,5-dimethyl-1,3-thiazol-2-yl)-3-hydrazinylpyridine-2-sulfonamide (PubChem CID 103301102) has the molecular formula C10H13N5O2S2 and a molecular weight of 299.38 g/mol. Its IUPAC name is N-(4,5-dimethyl-1,3-thiazol-2-yl)-3-hydrazinylpyridine-2-sulfonamide.
| Compound Name | N-(4,5-dimethyl-1,3-thiazol-2-yl)-3-hydrazinylpyridine-2-sulfonamide |
|---|---|
| PubChem CID | 103301102 |
| Molecular Formula | C10H13N5O2S2 |
| Molecular Weight | 299.38 g/mol |
| Exact Mass | 299.05 |
| IUPAC Name | N-(4,5-dimethyl-1,3-thiazol-2-yl)-3-hydrazinylpyridine-2-sulfonamide |
| SMILES | Cc1nc(NS(=O)(=O)c2ncccc2NN)sc1C |
| InChI | InChI=1S/C10H13N5O2S2/c1-6-7(2)18-10(13-6)15-19(16,17)9-8(14-11)4-3-5-12-9/h3-5,14H,11H2,1-2H3,(H,13,15) |
| InChIKey | DCQHODJGBUNSAK-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 110.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.38 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|