C10H11N3O2S2 — CID 55044038
2-(methylamino)-N-(1,3-thiazol-2-yl)benzenesulfonamide (PubChem CID 55044038) has the molecular formula C10H11N3O2S2 and a molecular weight of 269.35 g/mol. Its IUPAC name is 2-(methylamino)-N-(1,3-thiazol-2-yl)benzenesulfonamide.
| Compound Name | 2-(methylamino)-N-(1,3-thiazol-2-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 55044038 |
| Molecular Formula | C10H11N3O2S2 |
| Molecular Weight | 269.35 g/mol |
| Exact Mass | 269.03 |
| IUPAC Name | 2-(methylamino)-N-(1,3-thiazol-2-yl)benzenesulfonamide |
| SMILES | CNc1ccccc1S(=O)(=O)Nc1nccs1 |
| InChI | InChI=1S/C10H11N3O2S2/c1-11-8-4-2-3-5-9(8)17(14,15)13-10-12-6-7-16-10/h2-7,11H,1H3,(H,12,13) |
| InChIKey | CLQZHISFSVJVKG-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.35 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |