C8H7BrN2O2S3 — CID 71972231
5-bromo-2-methyl-N-(1,3-thiazol-2-yl)thiophene-3-sulfonamide (PubChem CID 71972231) has the molecular formula C8H7BrN2O2S3 and a molecular weight of 339.26 g/mol. Its IUPAC name is 5-bromo-2-methyl-N-(1,3-thiazol-2-yl)thiophene-3-sulfonamide.
| Compound Name | 5-bromo-2-methyl-N-(1,3-thiazol-2-yl)thiophene-3-sulfonamide |
|---|---|
| PubChem CID | 71972231 |
| Molecular Formula | C8H7BrN2O2S3 |
| Molecular Weight | 339.26 g/mol |
| Exact Mass | 337.89 |
| IUPAC Name | 5-bromo-2-methyl-N-(1,3-thiazol-2-yl)thiophene-3-sulfonamide |
| SMILES | Cc1sc(Br)cc1S(=O)(=O)Nc1nccs1 |
| InChI | InChI=1S/C8H7BrN2O2S3/c1-5-6(4-7(9)15-5)16(12,13)11-8-10-2-3-14-8/h2-4H,1H3,(H,10,11) |
| InChIKey | MBBHORWYAHVYFE-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.26 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |