C15H13N3O3S2 — CID 146763683
N-[5-(1,3-thiazol-2-ylsulfamoyl)naphthalen-1-yl]acetamide (PubChem CID 146763683) has the molecular formula C15H13N3O3S2 and a molecular weight of 347.42 g/mol. Its IUPAC name is N-[5-(1,3-thiazol-2-ylsulfamoyl)naphthalen-1-yl]acetamide.
| Compound Name | N-[5-(1,3-thiazol-2-ylsulfamoyl)naphthalen-1-yl]acetamide |
|---|---|
| PubChem CID | 146763683 |
| Molecular Formula | C15H13N3O3S2 |
| Molecular Weight | 347.42 g/mol |
| Exact Mass | 347.04 |
| IUPAC Name | N-[5-(1,3-thiazol-2-ylsulfamoyl)naphthalen-1-yl]acetamide |
| SMILES | CC(=O)Nc1cccc2c(S(=O)(=O)Nc3nccs3)cccc12 |
| InChI | InChI=1S/C15H13N3O3S2/c1-10(19)17-13-6-2-5-12-11(13)4-3-7-14(12)23(20,21)18-15-16-8-9-22-15/h2-9H,1H3,(H,16,18)(H,17,19) |
| InChIKey | OAAQNHOLRZBRFK-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 88.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.42 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |