C12H10ClNO4S — CID 141053746
chloro 5-acetamidonaphthalene-1-sulfonate (PubChem CID 141053746) has the molecular formula C12H10ClNO4S and a molecular weight of 299.74 g/mol. Its IUPAC name is chloro 5-acetamidonaphthalene-1-sulfonate.
| Compound Name | chloro 5-acetamidonaphthalene-1-sulfonate |
|---|---|
| PubChem CID | 141053746 |
| Molecular Formula | C12H10ClNO4S |
| Molecular Weight | 299.74 g/mol |
| Exact Mass | 299.00 |
| IUPAC Name | chloro 5-acetamidonaphthalene-1-sulfonate |
| SMILES | CC(=O)Nc1cccc2c(S(=O)(=O)OCl)cccc12 |
| InChI | InChI=1S/C12H10ClNO4S/c1-8(15)14-11-6-2-5-10-9(11)4-3-7-12(10)19(16,17)18-13/h2-7H,1H3,(H,14,15) |
| InChIKey | FUUMREKZQWTTKN-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.74 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |