C10H11N3O3S3 — CID 106270937
5-[(3-methyl-1,2-oxazol-5-yl)methylsulfamoyl]thiophene-2-carbothioamide (PubChem CID 106270937) has the molecular formula C10H11N3O3S3 and a molecular weight of 317.42 g/mol. Its IUPAC name is 5-[(3-methyl-1,2-oxazol-5-yl)methylsulfamoyl]thiophene-2-carbothioamide.
| Compound Name | 5-[(3-methyl-1,2-oxazol-5-yl)methylsulfamoyl]thiophene-2-carbothioamide |
|---|---|
| PubChem CID | 106270937 |
| Molecular Formula | C10H11N3O3S3 |
| Molecular Weight | 317.42 g/mol |
| Exact Mass | 317.00 |
| IUPAC Name | 5-[(3-methyl-1,2-oxazol-5-yl)methylsulfamoyl]thiophene-2-carbothioamide |
| SMILES | Cc1cc(CNS(=O)(=O)c2ccc(C(N)=S)s2)on1 |
| InChI | InChI=1S/C10H11N3O3S3/c1-6-4-7(16-13-6)5-12-19(14,15)9-3-2-8(18-9)10(11)17/h2-4,12H,5H2,1H3,(H2,11,17) |
| InChIKey | KERZWIXFZCBHMV-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 98.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.42 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|