C12H10BrFN2O2S3 — CID 63359168
4-[[(3-bromothiophen-2-yl)sulfonylamino]methyl]-3-fluorobenzenecarbothioamide (PubChem CID 63359168) has the molecular formula C12H10BrFN2O2S3 and a molecular weight of 409.33 g/mol. Its IUPAC name is 4-[[(3-bromothiophen-2-yl)sulfonylamino]methyl]-3-fluorobenzenecarbothioamide.
| Compound Name | 4-[[(3-bromothiophen-2-yl)sulfonylamino]methyl]-3-fluorobenzenecarbothioamide |
|---|---|
| PubChem CID | 63359168 |
| Molecular Formula | C12H10BrFN2O2S3 |
| Molecular Weight | 409.33 g/mol |
| Exact Mass | 407.91 |
| IUPAC Name | 4-[[(3-bromothiophen-2-yl)sulfonylamino]methyl]-3-fluorobenzenecarbothioamide |
| SMILES | NC(=S)c1ccc(CNS(=O)(=O)c2sccc2Br)c(F)c1 |
| InChI | InChI=1S/C12H10BrFN2O2S3/c13-9-3-4-20-12(9)21(17,18)16-6-8-2-1-7(11(15)19)5-10(8)14/h1-5,16H,6H2,(H2,15,19) |
| InChIKey | FYBZRRHYMQMWOU-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.33 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|