C12H18FN3O2S2 — CID 114815290
3-fluoro-4-[(2-methylpropylsulfamoylamino)methyl]benzenecarbothioamide (PubChem CID 114815290) has the molecular formula C12H18FN3O2S2 and a molecular weight of 319.43 g/mol. Its IUPAC name is 3-fluoro-4-[(2-methylpropylsulfamoylamino)methyl]benzenecarbothioamide.
| Compound Name | 3-fluoro-4-[(2-methylpropylsulfamoylamino)methyl]benzenecarbothioamide |
|---|---|
| PubChem CID | 114815290 |
| Molecular Formula | C12H18FN3O2S2 |
| Molecular Weight | 319.43 g/mol |
| Exact Mass | 319.08 |
| IUPAC Name | 3-fluoro-4-[(2-methylpropylsulfamoylamino)methyl]benzenecarbothioamide |
| SMILES | CC(C)CNS(=O)(=O)NCc1ccc(C(N)=S)cc1F |
| InChI | InChI=1S/C12H18FN3O2S2/c1-8(2)6-15-20(17,18)16-7-10-4-3-9(12(14)19)5-11(10)13/h3-5,8,15-16H,6-7H2,1-2H3,(H2,14,19) |
| InChIKey | CJAHQWSBFRSZLZ-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.43 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|