C11H17FN4O4S — CID 114816593
3-fluoro-N'-hydroxy-4-[(2-methoxyethylsulfamoylamino)methyl]benzenecarboximidamide (PubChem CID 114816593) has the molecular formula C11H17FN4O4S and a molecular weight of 320.35 g/mol. Its IUPAC name is 3-fluoro-N'-hydroxy-4-[(2-methoxyethylsulfamoylamino)methyl]benzenecarboximidamide.
| Compound Name | 3-fluoro-N'-hydroxy-4-[(2-methoxyethylsulfamoylamino)methyl]benzenecarboximidamide |
|---|---|
| PubChem CID | 114816593 |
| Molecular Formula | C11H17FN4O4S |
| Molecular Weight | 320.35 g/mol |
| Exact Mass | 320.10 |
| IUPAC Name | 3-fluoro-N'-hydroxy-4-[(2-methoxyethylsulfamoylamino)methyl]benzenecarboximidamide |
| SMILES | COCCNS(=O)(=O)NCc1ccc(/C(N)=N/O)cc1F |
| InChI | InChI=1S/C11H17FN4O4S/c1-20-5-4-14-21(18,19)15-7-9-3-2-8(6-10(9)12)11(13)16-17/h2-3,6,14-15,17H,4-5,7H2,1H3,(H2,13,16) |
| InChIKey | QDWGDOGXALCLOM-UHFFFAOYSA-N |
| XLogP | -0.51 |
| TPSA | 126.04 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.35 |
| LogP ≤ 5 | -0.51 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|