C10H15FN4O4S — CID 114816573
2-fluoro-N'-hydroxy-6-(2-methoxyethylsulfamoylamino)benzenecarboximidamide (PubChem CID 114816573) has the molecular formula C10H15FN4O4S and a molecular weight of 306.32 g/mol. Its IUPAC name is 2-fluoro-N'-hydroxy-6-(2-methoxyethylsulfamoylamino)benzenecarboximidamide.
| Compound Name | 2-fluoro-N'-hydroxy-6-(2-methoxyethylsulfamoylamino)benzenecarboximidamide |
|---|---|
| PubChem CID | 114816573 |
| Molecular Formula | C10H15FN4O4S |
| Molecular Weight | 306.32 g/mol |
| Exact Mass | 306.08 |
| IUPAC Name | 2-fluoro-N'-hydroxy-6-(2-methoxyethylsulfamoylamino)benzenecarboximidamide |
| SMILES | COCCNS(=O)(=O)Nc1cccc(F)c1/C(N)=N/O |
| InChI | InChI=1S/C10H15FN4O4S/c1-19-6-5-13-20(17,18)15-8-4-2-3-7(11)9(8)10(12)14-16/h2-4,13,15-16H,5-6H2,1H3,(H2,12,14) |
| InChIKey | HBFGXUYWJWMUSD-UHFFFAOYSA-N |
| XLogP | -0.19 |
| TPSA | 126.04 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.32 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|