C10H17N3O5S2 — CID 114816608
3-(2-methoxyethylsulfamoylamino)-2-methylbenzenesulfonamide (PubChem CID 114816608) has the molecular formula C10H17N3O5S2 and a molecular weight of 323.40 g/mol. Its IUPAC name is 3-(2-methoxyethylsulfamoylamino)-2-methylbenzenesulfonamide.
| Compound Name | 3-(2-methoxyethylsulfamoylamino)-2-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 114816608 |
| Molecular Formula | C10H17N3O5S2 |
| Molecular Weight | 323.40 g/mol |
| Exact Mass | 323.06 |
| IUPAC Name | 3-(2-methoxyethylsulfamoylamino)-2-methylbenzenesulfonamide |
| SMILES | COCCNS(=O)(=O)Nc1cccc(S(N)(=O)=O)c1C |
| InChI | InChI=1S/C10H17N3O5S2/c1-8-9(4-3-5-10(8)19(11,14)15)13-20(16,17)12-6-7-18-2/h3-5,12-13H,6-7H2,1-2H3,(H2,11,14,15) |
| InChIKey | YRUNDLOKNIXCAB-UHFFFAOYSA-N |
| XLogP | -0.46 |
| TPSA | 127.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.40 |
| LogP ≤ 5 | -0.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|