C12H20N2O5S2 — CID 79593105
2-methyl-3-(2-propan-2-yloxyethylsulfonylamino)benzenesulfonamide (PubChem CID 79593105) has the molecular formula C12H20N2O5S2 and a molecular weight of 336.44 g/mol. Its IUPAC name is 2-methyl-3-(2-propan-2-yloxyethylsulfonylamino)benzenesulfonamide.
| Compound Name | 2-methyl-3-(2-propan-2-yloxyethylsulfonylamino)benzenesulfonamide |
|---|---|
| PubChem CID | 79593105 |
| Molecular Formula | C12H20N2O5S2 |
| Molecular Weight | 336.44 g/mol |
| Exact Mass | 336.08 |
| IUPAC Name | 2-methyl-3-(2-propan-2-yloxyethylsulfonylamino)benzenesulfonamide |
| SMILES | Cc1c(NS(=O)(=O)CCOC(C)C)cccc1S(N)(=O)=O |
| InChI | InChI=1S/C12H20N2O5S2/c1-9(2)19-7-8-20(15,16)14-11-5-4-6-12(10(11)3)21(13,17)18/h4-6,9,14H,7-8H2,1-3H3,(H2,13,17,18) |
| InChIKey | XXHSMTCBKJASRM-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 115.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.44 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |