C11H18N2O4S2 — CID 63821952
2-(3-methylbutylsulfonylamino)benzenesulfonamide (PubChem CID 63821952) has the molecular formula C11H18N2O4S2 and a molecular weight of 306.41 g/mol. Its IUPAC name is 2-(3-methylbutylsulfonylamino)benzenesulfonamide.
| Compound Name | 2-(3-methylbutylsulfonylamino)benzenesulfonamide |
|---|---|
| PubChem CID | 63821952 |
| Molecular Formula | C11H18N2O4S2 |
| Molecular Weight | 306.41 g/mol |
| Exact Mass | 306.07 |
| IUPAC Name | 2-(3-methylbutylsulfonylamino)benzenesulfonamide |
| SMILES | CC(C)CCS(=O)(=O)Nc1ccccc1S(N)(=O)=O |
| InChI | InChI=1S/C11H18N2O4S2/c1-9(2)7-8-18(14,15)13-10-5-3-4-6-11(10)19(12,16)17/h3-6,9,13H,7-8H2,1-2H3,(H2,12,16,17) |
| InChIKey | RLSAFDMHTRUYCS-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 106.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.41 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |