C11H18N2O2S — CID 62692672
2-(2-methylbutylamino)benzenesulfonamide (PubChem CID 62692672) has the molecular formula C11H18N2O2S and a molecular weight of 242.34 g/mol. Its IUPAC name is 2-(2-methylbutylamino)benzenesulfonamide.
| Compound Name | 2-(2-methylbutylamino)benzenesulfonamide |
|---|---|
| PubChem CID | 62692672 |
| Molecular Formula | C11H18N2O2S |
| Molecular Weight | 242.34 g/mol |
| Exact Mass | 242.11 |
| IUPAC Name | 2-(2-methylbutylamino)benzenesulfonamide |
| SMILES | CCC(C)CNc1ccccc1S(N)(=O)=O |
| InChI | InChI=1S/C11H18N2O2S/c1-3-9(2)8-13-10-6-4-5-7-11(10)16(12,14)15/h4-7,9,13H,3,8H2,1-2H3,(H2,12,14,15) |
| InChIKey | CTENMZSDMRPCJV-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.34 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |