C11H18N2O4S — CID 114100732
2-(2,3-dimethoxypropylamino)benzenesulfonamide (PubChem CID 114100732) has the molecular formula C11H18N2O4S and a molecular weight of 274.34 g/mol. Its IUPAC name is 2-(2,3-dimethoxypropylamino)benzenesulfonamide.
| Compound Name | 2-(2,3-dimethoxypropylamino)benzenesulfonamide |
|---|---|
| PubChem CID | 114100732 |
| Molecular Formula | C11H18N2O4S |
| Molecular Weight | 274.34 g/mol |
| Exact Mass | 274.10 |
| IUPAC Name | 2-(2,3-dimethoxypropylamino)benzenesulfonamide |
| SMILES | COCC(CNc1ccccc1S(N)(=O)=O)OC |
| InChI | InChI=1S/C11H18N2O4S/c1-16-8-9(17-2)7-13-10-5-3-4-6-11(10)18(12,14)15/h3-6,9,13H,7-8H2,1-2H3,(H2,12,14,15) |
| InChIKey | ZITGUBJEFGTEMG-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.34 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |