C9H13N3O4S — CID 106170840
2-hydroxy-3-(2-sulfamoylanilino)propanamide (PubChem CID 106170840) has the molecular formula C9H13N3O4S and a molecular weight of 259.29 g/mol. Its IUPAC name is 2-hydroxy-3-(2-sulfamoylanilino)propanamide.
| Compound Name | 2-hydroxy-3-(2-sulfamoylanilino)propanamide |
|---|---|
| PubChem CID | 106170840 |
| Molecular Formula | C9H13N3O4S |
| Molecular Weight | 259.29 g/mol |
| Exact Mass | 259.06 |
| IUPAC Name | 2-hydroxy-3-(2-sulfamoylanilino)propanamide |
| SMILES | NC(=O)C(O)CNc1ccccc1S(N)(=O)=O |
| InChI | InChI=1S/C9H13N3O4S/c10-9(14)7(13)5-12-6-3-1-2-4-8(6)17(11,15)16/h1-4,7,12-13H,5H2,(H2,10,14)(H2,11,15,16) |
| InChIKey | YITLLLAUOAAIPK-UHFFFAOYSA-N |
| XLogP | -1.41 |
| TPSA | 135.51 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.29 |
| LogP ≤ 5 | -1.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |