C9H14N4O4S — CID 106166600
3-(2-amino-4-sulfamoylanilino)-2-hydroxypropanamide (PubChem CID 106166600) has the molecular formula C9H14N4O4S and a molecular weight of 274.30 g/mol. Its IUPAC name is 3-(2-amino-4-sulfamoylanilino)-2-hydroxypropanamide.
| Compound Name | 3-(2-amino-4-sulfamoylanilino)-2-hydroxypropanamide |
|---|---|
| PubChem CID | 106166600 |
| Molecular Formula | C9H14N4O4S |
| Molecular Weight | 274.30 g/mol |
| Exact Mass | 274.07 |
| IUPAC Name | 3-(2-amino-4-sulfamoylanilino)-2-hydroxypropanamide |
| SMILES | NC(=O)C(O)CNc1ccc(S(N)(=O)=O)cc1N |
| InChI | InChI=1S/C9H14N4O4S/c10-6-3-5(18(12,16)17)1-2-7(6)13-4-8(14)9(11)15/h1-3,8,13-14H,4,10H2,(H2,11,15)(H2,12,16,17) |
| InChIKey | UNCNMTYJRCFYJB-UHFFFAOYSA-N |
| XLogP | -1.83 |
| TPSA | 161.53 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.30 |
| LogP ≤ 5 | -1.83 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|