C8H10F2N2O2S — CID 115407559
2-(2,2-difluoroethylamino)benzenesulfonamide (PubChem CID 115407559) has the molecular formula C8H10F2N2O2S and a molecular weight of 236.24 g/mol. Its IUPAC name is 2-(2,2-difluoroethylamino)benzenesulfonamide.
| Compound Name | 2-(2,2-difluoroethylamino)benzenesulfonamide |
|---|---|
| PubChem CID | 115407559 |
| Molecular Formula | C8H10F2N2O2S |
| Molecular Weight | 236.24 g/mol |
| Exact Mass | 236.04 |
| IUPAC Name | 2-(2,2-difluoroethylamino)benzenesulfonamide |
| SMILES | NS(=O)(=O)c1ccccc1NCC(F)F |
| InChI | InChI=1S/C8H10F2N2O2S/c9-8(10)5-12-6-3-1-2-4-7(6)15(11,13)14/h1-4,8,12H,5H2,(H2,11,13,14) |
| InChIKey | SNUCMWVYPHCHPW-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.24 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |