C11H16F2N2O2S — CID 113303827
2-(2,2-difluoroethylamino)-N-propan-2-ylbenzenesulfonamide (PubChem CID 113303827) has the molecular formula C11H16F2N2O2S and a molecular weight of 278.32 g/mol. Its IUPAC name is 2-(2,2-difluoroethylamino)-N-propan-2-ylbenzenesulfonamide.
| Compound Name | 2-(2,2-difluoroethylamino)-N-propan-2-ylbenzenesulfonamide |
|---|---|
| PubChem CID | 113303827 |
| Molecular Formula | C11H16F2N2O2S |
| Molecular Weight | 278.32 g/mol |
| Exact Mass | 278.09 |
| IUPAC Name | 2-(2,2-difluoroethylamino)-N-propan-2-ylbenzenesulfonamide |
| SMILES | CC(C)NS(=O)(=O)c1ccccc1NCC(F)F |
| InChI | InChI=1S/C11H16F2N2O2S/c1-8(2)15-18(16,17)10-6-4-3-5-9(10)14-7-11(12)13/h3-6,8,11,14-15H,7H2,1-2H3 |
| InChIKey | PHJUQPOMNXJSME-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.32 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |