C14H24N2O3S — CID 107318077
2-(5-hydroxypentylamino)-N-propan-2-ylbenzenesulfonamide (PubChem CID 107318077) has the molecular formula C14H24N2O3S and a molecular weight of 300.42 g/mol. Its IUPAC name is 2-(5-hydroxypentylamino)-N-propan-2-ylbenzenesulfonamide.
| Compound Name | 2-(5-hydroxypentylamino)-N-propan-2-ylbenzenesulfonamide |
|---|---|
| PubChem CID | 107318077 |
| Molecular Formula | C14H24N2O3S |
| Molecular Weight | 300.42 g/mol |
| Exact Mass | 300.15 |
| IUPAC Name | 2-(5-hydroxypentylamino)-N-propan-2-ylbenzenesulfonamide |
| SMILES | CC(C)NS(=O)(=O)c1ccccc1NCCCCCO |
| InChI | InChI=1S/C14H24N2O3S/c1-12(2)16-20(18,19)14-9-5-4-8-13(14)15-10-6-3-7-11-17/h4-5,8-9,12,15-17H,3,6-7,10-11H2,1-2H3 |
| InChIKey | QELLYMDAKOJING-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.42 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|