C10H13F2NO3S — CID 43455403
3-[2-(difluoromethylsulfonyl)anilino]propan-1-ol (PubChem CID 43455403) has the molecular formula C10H13F2NO3S and a molecular weight of 265.28 g/mol. Its IUPAC name is 3-[2-(difluoromethylsulfonyl)anilino]propan-1-ol.
| Compound Name | 3-[2-(difluoromethylsulfonyl)anilino]propan-1-ol |
|---|---|
| PubChem CID | 43455403 |
| Molecular Formula | C10H13F2NO3S |
| Molecular Weight | 265.28 g/mol |
| Exact Mass | 265.06 |
| IUPAC Name | 3-[2-(difluoromethylsulfonyl)anilino]propan-1-ol |
| SMILES | O=S(=O)(c1ccccc1NCCCO)C(F)F |
| InChI | InChI=1S/C10H13F2NO3S/c11-10(12)17(15,16)9-5-2-1-4-8(9)13-6-3-7-14/h1-2,4-5,10,13-14H,3,6-7H2 |
| InChIKey | DNAFCKKHHLIMJB-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.28 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|