C13H19F2NO3S — CID 103705332
4-[2-(difluoromethylsulfonyl)anilino]-3,3-dimethylbutan-1-ol (PubChem CID 103705332) has the molecular formula C13H19F2NO3S and a molecular weight of 307.36 g/mol. Its IUPAC name is 4-[2-(difluoromethylsulfonyl)anilino]-3,3-dimethylbutan-1-ol.
| Compound Name | 4-[2-(difluoromethylsulfonyl)anilino]-3,3-dimethylbutan-1-ol |
|---|---|
| PubChem CID | 103705332 |
| Molecular Formula | C13H19F2NO3S |
| Molecular Weight | 307.36 g/mol |
| Exact Mass | 307.11 |
| IUPAC Name | 4-[2-(difluoromethylsulfonyl)anilino]-3,3-dimethylbutan-1-ol |
| SMILES | CC(C)(CCO)CNc1ccccc1S(=O)(=O)C(F)F |
| InChI | InChI=1S/C13H19F2NO3S/c1-13(2,7-8-17)9-16-10-5-3-4-6-11(10)20(18,19)12(14)15/h3-6,12,16-17H,7-9H2,1-2H3 |
| InChIKey | PIUBKRIWTSBQIR-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.36 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |