C13H17ClF3NO2S — CID 106141852
N-(4-chloro-2,2-dimethylbutyl)-2-(trifluoromethylsulfonyl)aniline (PubChem CID 106141852) has the molecular formula C13H17ClF3NO2S and a molecular weight of 343.80 g/mol. Its IUPAC name is N-(4-chloro-2,2-dimethylbutyl)-2-(trifluoromethylsulfonyl)aniline.
| Compound Name | N-(4-chloro-2,2-dimethylbutyl)-2-(trifluoromethylsulfonyl)aniline |
|---|---|
| PubChem CID | 106141852 |
| Molecular Formula | C13H17ClF3NO2S |
| Molecular Weight | 343.80 g/mol |
| Exact Mass | 343.06 |
| IUPAC Name | N-(4-chloro-2,2-dimethylbutyl)-2-(trifluoromethylsulfonyl)aniline |
| SMILES | CC(C)(CCCl)CNc1ccccc1S(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C13H17ClF3NO2S/c1-12(2,7-8-14)9-18-10-5-3-4-6-11(10)21(19,20)13(15,16)17/h3-6,18H,7-9H2,1-2H3 |
| InChIKey | KQQQHAWWNPXLCX-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.80 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|