C11H14F3NO3S — CID 61362995
2-methyl-3-[2-(trifluoromethylsulfonyl)anilino]propan-1-ol (PubChem CID 61362995) has the molecular formula C11H14F3NO3S and a molecular weight of 297.30 g/mol. Its IUPAC name is 2-methyl-3-[2-(trifluoromethylsulfonyl)anilino]propan-1-ol.
| Compound Name | 2-methyl-3-[2-(trifluoromethylsulfonyl)anilino]propan-1-ol |
|---|---|
| PubChem CID | 61362995 |
| Molecular Formula | C11H14F3NO3S |
| Molecular Weight | 297.30 g/mol |
| Exact Mass | 297.06 |
| IUPAC Name | 2-methyl-3-[2-(trifluoromethylsulfonyl)anilino]propan-1-ol |
| SMILES | CC(CO)CNc1ccccc1S(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C11H14F3NO3S/c1-8(7-16)6-15-9-4-2-3-5-10(9)19(17,18)11(12,13)14/h2-5,8,15-16H,6-7H2,1H3 |
| InChIKey | JGFBARMAAIKMFR-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.30 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |