C10H12F3NO3S — CID 43427898
1-[2-(trifluoromethylsulfonyl)anilino]propan-2-ol (PubChem CID 43427898) has the molecular formula C10H12F3NO3S and a molecular weight of 283.27 g/mol. Its IUPAC name is 1-[2-(trifluoromethylsulfonyl)anilino]propan-2-ol.
| Compound Name | 1-[2-(trifluoromethylsulfonyl)anilino]propan-2-ol |
|---|---|
| PubChem CID | 43427898 |
| Molecular Formula | C10H12F3NO3S |
| Molecular Weight | 283.27 g/mol |
| Exact Mass | 283.05 |
| IUPAC Name | 1-[2-(trifluoromethylsulfonyl)anilino]propan-2-ol |
| SMILES | CC(O)CNc1ccccc1S(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C10H12F3NO3S/c1-7(15)6-14-8-4-2-3-5-9(8)18(16,17)10(11,12)13/h2-5,7,14-15H,6H2,1H3 |
| InChIKey | IOSUMWJPEJORAD-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.27 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |