C10H11ClF3NO2S — CID 65027421
N-(2-chloropropyl)-2-(trifluoromethylsulfonyl)aniline (PubChem CID 65027421) has the molecular formula C10H11ClF3NO2S and a molecular weight of 301.72 g/mol. Its IUPAC name is N-(2-chloropropyl)-2-(trifluoromethylsulfonyl)aniline.
| Compound Name | N-(2-chloropropyl)-2-(trifluoromethylsulfonyl)aniline |
|---|---|
| PubChem CID | 65027421 |
| Molecular Formula | C10H11ClF3NO2S |
| Molecular Weight | 301.72 g/mol |
| Exact Mass | 301.02 |
| IUPAC Name | N-(2-chloropropyl)-2-(trifluoromethylsulfonyl)aniline |
| SMILES | CC(Cl)CNc1ccccc1S(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C10H11ClF3NO2S/c1-7(11)6-15-8-4-2-3-5-9(8)18(16,17)10(12,13)14/h2-5,7,15H,6H2,1H3 |
| InChIKey | YSYJBFZIOKUUOW-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.72 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|